Characteristics
|
R406 is a potent SYK (Spleen Tyrosine Kinase) inhibitor (IC₅₀ = 41 nM). R406 strongly inhibits SYK but not Lyn, and displays 5-fold less potency towards FLT3. R406 induces apoptosis in diffuse large B-cell lymphoma cell lines. It blocks B cell receptor signaling through inhibition of SYK autophosphorylation of Y525/Y526 and SYK-dependent phosphorylation of the B-cell linker protein. Smiles: CC1(C(=O)NC2=C(O1)C=CC(=N2)NC3=NC(=NC=C3F)NC4=CC(=C(C(=C4)OC)OC)OC)C InChi: InChI=1S/C22H23FN6O5/c1-22(2)20(30)28-19-13(34-22)6-7-16(27-19)26-18-12(23)10-24-21(29-18)25-11-8-14(31-3)17(33-5)15(9-11)32-4/h6-10H,1-5H3,(H3,24,25,26,27,28,29,30) Inchi Key: NHHQJBCNYHBUSI-UHFFFAOYSA-N
|